C22H18ClN9 — CID 145483334
N'-amino-2-[8-chloro-3-[(7H-purin-6-ylamino)methyl]quinolin-2-yl]benzenecarboximidamide (PubChem CID 145483334) has the molecular formula C22H18ClN9 and a molecular weight of 443.90 g/mol. Its IUPAC name is N'-amino-2-[8-chloro-3-[(7H-purin-6-ylamino)methyl]quinolin-2-yl]benzenecarboximidamide.
| Compound Name | N'-amino-2-[8-chloro-3-[(7H-purin-6-ylamino)methyl]quinolin-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145483334 |
| Molecular Formula | C22H18ClN9 |
| Molecular Weight | 443.90 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | N'-amino-2-[8-chloro-3-[(7H-purin-6-ylamino)methyl]quinolin-2-yl]benzenecarboximidamide |
| SMILES | N/N=C(\N)c1ccccc1-c1nc2c(Cl)cccc2cc1CNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C22H18ClN9/c23-16-7-3-4-12-8-13(9-26-21-19-22(28-10-27-19)30-11-29-21)17(31-18(12)16)14-5-1-2-6-15(14)20(24)32-25/h1-8,10-11H,9,25H2,(H2,24,32)(H2,26,27,28,29,30) |
| InChIKey | WSCZETNMUXTTLX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.90 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|