C20H12ClFIN7 — CID 25096288
1-[[3-(2-chlorophenyl)-5-fluoroquinoxalin-2-yl]methyl]-3-iodopyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 25096288) has the molecular formula C20H12ClFIN7 and a molecular weight of 531.72 g/mol. Its IUPAC name is 1-[[3-(2-chlorophenyl)-5-fluoroquinoxalin-2-yl]methyl]-3-iodopyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-[[3-(2-chlorophenyl)-5-fluoroquinoxalin-2-yl]methyl]-3-iodopyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 25096288 |
| Molecular Formula | C20H12ClFIN7 |
| Molecular Weight | 531.72 g/mol |
| Exact Mass | 530.99 |
| IUPAC Name | 1-[[3-(2-chlorophenyl)-5-fluoroquinoxalin-2-yl]methyl]-3-iodopyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c1c(I)nn2Cc1nc2cccc(F)c2nc1-c1ccccc1Cl |
| InChI | InChI=1S/C20H12ClFIN7/c21-11-5-2-1-4-10(11)16-14(27-13-7-3-6-12(22)17(13)28-16)8-30-20-15(18(23)29-30)19(24)25-9-26-20/h1-7,9H,8H2,(H2,24,25,26) |
| InChIKey | JFVBFHDHKFMLMW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.72 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|