C14H13IN6O2 — CID 175533263
[4-[(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)methyl]phenyl]methyl carbamate (PubChem CID 175533263) has the molecular formula C14H13IN6O2 and a molecular weight of 424.20 g/mol. Its IUPAC name is [4-[(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)methyl]phenyl]methyl carbamate.
| Compound Name | [4-[(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)methyl]phenyl]methyl carbamate |
|---|---|
| PubChem CID | 175533263 |
| Molecular Formula | C14H13IN6O2 |
| Molecular Weight | 424.20 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | [4-[(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)methyl]phenyl]methyl carbamate |
| SMILES | NC(=O)OCc1ccc(Cn2nc(I)c3c(N)ncnc32)cc1 |
| InChI | InChI=1S/C14H13IN6O2/c15-11-10-12(16)18-7-19-13(10)21(20-11)5-8-1-3-9(4-2-8)6-23-14(17)22/h1-4,7H,5-6H2,(H2,17,22)(H2,16,18,19) |
| InChIKey | FVHULEVADNUDPD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 121.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|