C15H21IN6O2 — CID 174711996
tert-butyl (3R)-3-[(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)methyl]-2-iminopentanoate (PubChem CID 174711996) has the molecular formula C15H21IN6O2 and a molecular weight of 444.28 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)methyl]-2-iminopentanoate.
| Compound Name | tert-butyl (3R)-3-[(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)methyl]-2-iminopentanoate |
|---|---|
| PubChem CID | 174711996 |
| Molecular Formula | C15H21IN6O2 |
| Molecular Weight | 444.28 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | tert-butyl (3R)-3-[(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)methyl]-2-iminopentanoate |
| SMILES | [H]/N=C(\C(=O)OC(C)(C)C)[C@H](CC)Cn1nc(I)c2c(N)ncnc21 |
| InChI | InChI=1S/C15H21IN6O2/c1-5-8(10(17)14(23)24-15(2,3)4)6-22-13-9(11(16)21-22)12(18)19-7-20-13/h7-8,17H,5-6H2,1-4H3,(H2,18,19,20)/b17-10-/t8-/m1/s1 |
| InChIKey | YEACLBZFKHURRT-VHSWAEMSSA-N |
| XLogP | 2.40 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|