C11H16IN5O2 — CID 122705250
1-(2,2-diethoxyethyl)-3-iodopyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 122705250) has the molecular formula C11H16IN5O2 and a molecular weight of 377.19 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-3-iodopyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-(2,2-diethoxyethyl)-3-iodopyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 122705250 |
| Molecular Formula | C11H16IN5O2 |
| Molecular Weight | 377.19 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-3-iodopyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCOC(Cn1nc(I)c2c(N)ncnc21)OCC |
| InChI | InChI=1S/C11H16IN5O2/c1-3-18-7(19-4-2)5-17-11-8(9(12)16-17)10(13)14-6-15-11/h6-7H,3-5H2,1-2H3,(H2,13,14,15) |
| InChIKey | QWDOJRJWYFVHDT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|