C11H15IN6 — CID 71217432
3-iodo-1-(piperidin-4-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 71217432) has the molecular formula C11H15IN6 and a molecular weight of 358.19 g/mol. Its IUPAC name is 3-iodo-1-(piperidin-4-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-iodo-1-(piperidin-4-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 71217432 |
| Molecular Formula | C11H15IN6 |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 3-iodo-1-(piperidin-4-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c1c(I)nn2CC1CCNCC1 |
| InChI | InChI=1S/C11H15IN6/c12-9-8-10(13)15-6-16-11(8)18(17-9)5-7-1-3-14-4-2-7/h6-7,14H,1-5H2,(H2,13,15,16) |
| InChIKey | RGABWANAKNSDKQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|