C8H10IN5 — CID 24905337
3-iodo-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 24905337) has the molecular formula C8H10IN5 and a molecular weight of 303.11 g/mol. Its IUPAC name is 3-iodo-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-iodo-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 24905337 |
| Molecular Formula | C8H10IN5 |
| Molecular Weight | 303.11 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 3-iodo-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CC(C)n1nc(I)c2c(N)ncnc21 |
| InChI | InChI=1S/C8H10IN5/c1-4(2)14-8-5(6(9)13-14)7(10)11-3-12-8/h3-4H,1-2H3,(H2,10,11,12) |
| InChIKey | OZULUFUHMFFLQF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.11 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|