C16H23IN6O2 — CID 141497445
tert-butyl 5-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)-2-methylpiperidine-1-carboxylate (PubChem CID 141497445) has the molecular formula C16H23IN6O2 and a molecular weight of 458.30 g/mol. Its IUPAC name is tert-butyl 5-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)-2-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 5-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 141497445 |
| Molecular Formula | C16H23IN6O2 |
| Molecular Weight | 458.30 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | tert-butyl 5-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)-2-methylpiperidine-1-carboxylate |
| SMILES | CC1CCC(n2nc(I)c3c(N)ncnc32)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23IN6O2/c1-9-5-6-10(7-22(9)15(24)25-16(2,3)4)23-14-11(12(17)21-23)13(18)19-8-20-14/h8-10H,5-7H2,1-4H3,(H2,18,19,20) |
| InChIKey | LNCJHUIAQFSPMP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|