C20H25N7O2 — CID 66990874
tert-butyl 3-[4-amino-3-(4-aminophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidine-1-carboxylate (PubChem CID 66990874) has the molecular formula C20H25N7O2 and a molecular weight of 395.47 g/mol. Its IUPAC name is tert-butyl 3-[4-amino-3-(4-aminophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-amino-3-(4-aminophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66990874 |
| Molecular Formula | C20H25N7O2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | tert-butyl 3-[4-amino-3-(4-aminophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2nc(-c3ccc(N)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C20H25N7O2/c1-20(2,3)29-19(28)26-9-8-14(10-26)27-18-15(17(22)23-11-24-18)16(25-27)12-4-6-13(21)7-5-12/h4-7,11,14H,8-10,21H2,1-3H3,(H2,22,23,24) |
| InChIKey | KYAMALLDQFUZPV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 125.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|