C20H23N7O4 — CID 58506806
tert-butyl (3S)-3-[4-amino-3-(4-nitrophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidine-1-carboxylate (PubChem CID 58506806) has the molecular formula C20H23N7O4 and a molecular weight of 425.45 g/mol. Its IUPAC name is tert-butyl (3S)-3-[4-amino-3-(4-nitrophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[4-amino-3-(4-nitrophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58506806 |
| Molecular Formula | C20H23N7O4 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | tert-butyl (3S)-3-[4-amino-3-(4-nitrophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](n2nc(-c3ccc([N+](=O)[O-])cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C20H23N7O4/c1-20(2,3)31-19(28)25-9-8-14(10-25)26-18-15(17(21)22-11-23-18)16(24-26)12-4-6-13(7-5-12)27(29)30/h4-7,11,14H,8-10H2,1-3H3,(H2,21,22,23)/t14-/m0/s1 |
| InChIKey | LBZUNRCHGRYDMM-AWEZNQCLSA-N |
| XLogP | 3.17 |
| TPSA | 142.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|