C21H24FN7O4 — CID 162386390
tert-butyl 4-[4-amino-3-(3-fluoro-4-nitrophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carboxylate (PubChem CID 162386390) has the molecular formula C21H24FN7O4 and a molecular weight of 457.47 g/mol. Its IUPAC name is tert-butyl 4-[4-amino-3-(3-fluoro-4-nitrophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-amino-3-(3-fluoro-4-nitrophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 162386390 |
| Molecular Formula | C21H24FN7O4 |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | tert-butyl 4-[4-amino-3-(3-fluoro-4-nitrophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2nc(-c3ccc([N+](=O)[O-])c(F)c3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C21H24FN7O4/c1-21(2,3)33-20(30)27-8-6-13(7-9-27)28-19-16(18(23)24-11-25-19)17(26-28)12-4-5-15(29(31)32)14(22)10-12/h4-5,10-11,13H,6-9H2,1-3H3,(H2,23,24,25) |
| InChIKey | OSYDJMGDKAYZAE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 142.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|