C27H28FN7O5 — CID 118494245
tert-butyl 3-[4-amino-3-[2-fluoro-4-(2-nitrophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carboxylate (PubChem CID 118494245) has the molecular formula C27H28FN7O5 and a molecular weight of 549.56 g/mol. Its IUPAC name is tert-butyl 3-[4-amino-3-[2-fluoro-4-(2-nitrophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-amino-3-[2-fluoro-4-(2-nitrophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118494245 |
| Molecular Formula | C27H28FN7O5 |
| Molecular Weight | 549.56 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | tert-butyl 3-[4-amino-3-[2-fluoro-4-(2-nitrophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(n2nc(-c3ccc(Oc4ccccc4[N+](=O)[O-])cc3F)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C27H28FN7O5/c1-27(2,3)40-26(36)33-12-6-7-16(14-33)34-25-22(24(29)30-15-31-25)23(32-34)18-11-10-17(13-19(18)28)39-21-9-5-4-8-20(21)35(37)38/h4-5,8-11,13,15-16H,6-7,12,14H2,1-3H3,(H2,29,30,31) |
| InChIKey | JVUHLWXVBKBJNJ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 151.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|