C32H33FN8O2 — CID 71015299
(Z)-2-[(3R)-3-[4-amino-3-(2-fluoro-4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-4-(cyclopropylamino)-4-methylpent-2-enenitrile (PubChem CID 71015299) has the molecular formula C32H33FN8O2 and a molecular weight of 580.67 g/mol. Its IUPAC name is (Z)-2-[(3R)-3-[4-amino-3-(2-fluoro-4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-4-(cyclopropylamino)-4-methylpent-2-enenitrile.
| Compound Name | (Z)-2-[(3R)-3-[4-amino-3-(2-fluoro-4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-4-(cyclopropylamino)-4-methylpent-2-enenitrile |
|---|---|
| PubChem CID | 71015299 |
| Molecular Formula | C32H33FN8O2 |
| Molecular Weight | 580.67 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | (Z)-2-[(3R)-3-[4-amino-3-(2-fluoro-4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-4-(cyclopropylamino)-4-methylpent-2-enenitrile |
| SMILES | CC(C)(/C=C(/C#N)C(=O)N1CCC[C@@H](n2nc(-c3ccc(Oc4ccccc4)cc3F)c3c(N)ncnc32)C1)NC1CC1 |
| InChI | InChI=1S/C32H33FN8O2/c1-32(2,38-21-10-11-21)16-20(17-34)31(42)40-14-6-7-22(18-40)41-30-27(29(35)36-19-37-30)28(39-41)25-13-12-24(15-26(25)33)43-23-8-4-3-5-9-23/h3-5,8-9,12-13,15-16,19,21-22,38H,6-7,10-11,14,18H2,1-2H3,(H2,35,36,37)/b20-16-/t22-/m1/s1 |
| InChIKey | OYEWCPLOZQWRTA-JXAXNMIRSA-N |
| XLogP | 5.15 |
| TPSA | 134.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.67 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|