C32H33FN8O3 — CID 90003658
(Z)-2-[3-[4-amino-3-(2-fluoro-4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-4-methyl-4-(oxetan-3-ylamino)pent-2-enenitrile (PubChem CID 90003658) has the molecular formula C32H33FN8O3 and a molecular weight of 596.67 g/mol. Its IUPAC name is (Z)-2-[3-[4-amino-3-(2-fluoro-4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-4-methyl-4-(oxetan-3-ylamino)pent-2-enenitrile.
| Compound Name | (Z)-2-[3-[4-amino-3-(2-fluoro-4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-4-methyl-4-(oxetan-3-ylamino)pent-2-enenitrile |
|---|---|
| PubChem CID | 90003658 |
| Molecular Formula | C32H33FN8O3 |
| Molecular Weight | 596.67 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | (Z)-2-[3-[4-amino-3-(2-fluoro-4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-4-methyl-4-(oxetan-3-ylamino)pent-2-enenitrile |
| SMILES | CC(C)(/C=C(/C#N)C(=O)N1CCCC(n2nc(-c3ccc(Oc4ccccc4)cc3F)c3c(N)ncnc32)C1)NC1COC1 |
| InChI | InChI=1S/C32H33FN8O3/c1-32(2,38-21-17-43-18-21)14-20(15-34)31(42)40-12-6-7-22(16-40)41-30-27(29(35)36-19-37-30)28(39-41)25-11-10-24(13-26(25)33)44-23-8-4-3-5-9-23/h3-5,8-11,13-14,19,21-22,38H,6-7,12,16-18H2,1-2H3,(H2,35,36,37)/b20-14- |
| InChIKey | VUTVENMKYADLMM-ZHZULCJRSA-N |
| XLogP | 4.39 |
| TPSA | 144.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.67 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|