C33H34IN6O2P — CID 130277067
tert-butyl (2S,4R)-4-[3-iodo-4-[(triphenyl-λ5-phosphanylidene)amino]pyrazolo[3,4-d]pyrimidin-1-yl]-2-methylpyrrolidine-1-carboxylate (PubChem CID 130277067) has the molecular formula C33H34IN6O2P and a molecular weight of 704.55 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-[3-iodo-4-[(triphenyl-λ5-phosphanylidene)amino]pyrazolo[3,4-d]pyrimidin-1-yl]-2-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-[3-iodo-4-[(triphenyl-λ5-phosphanylidene)amino]pyrazolo[3,4-d]pyrimidin-1-yl]-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 130277067 |
| Molecular Formula | C33H34IN6O2P |
| Molecular Weight | 704.55 g/mol |
| Exact Mass | 704.15 |
| IUPAC Name | tert-butyl (2S,4R)-4-[3-iodo-4-[(triphenyl-λ5-phosphanylidene)amino]pyrazolo[3,4-d]pyrimidin-1-yl]-2-methylpyrrolidine-1-carboxylate |
| SMILES | C[C@H]1C[C@@H](n2nc(I)c3c(N=P(c4ccccc4)(c4ccccc4)c4ccccc4)ncnc32)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H34IN6O2P/c1-23-20-24(21-39(23)32(41)42-33(2,3)4)40-31-28(29(34)37-40)30(35-22-36-31)38-43(25-14-8-5-9-15-25,26-16-10-6-11-17-26)27-18-12-7-13-19-27/h5-19,22-24H,20-21H2,1-4H3/t23-,24+/m0/s1 |
| InChIKey | XICKLCJKWBPALZ-BJKOFHAPSA-N |
| XLogP | 6.81 |
| TPSA | 85.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.55 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|