C21H32N6O3Si — CID 162382313
tert-butyl (2R,4S)-4-[4-amino-3-(2-trimethylsilylethynyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2-(methoxymethyl)pyrrolidine-1-carboxylate (PubChem CID 162382313) has the molecular formula C21H32N6O3Si and a molecular weight of 444.61 g/mol. Its IUPAC name is tert-butyl (2R,4S)-4-[4-amino-3-(2-trimethylsilylethynyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2-(methoxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-4-[4-amino-3-(2-trimethylsilylethynyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2-(methoxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 162382313 |
| Molecular Formula | C21H32N6O3Si |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | tert-butyl (2R,4S)-4-[4-amino-3-(2-trimethylsilylethynyl)pyrazolo[3,4-d]pyrimidin-1-yl]-2-(methoxymethyl)pyrrolidine-1-carboxylate |
| SMILES | COC[C@H]1C[C@H](n2nc(C#C[Si](C)(C)C)c3c(N)ncnc32)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H32N6O3Si/c1-21(2,3)30-20(28)26-11-14(10-15(26)12-29-4)27-19-17(18(22)23-13-24-19)16(25-27)8-9-31(5,6)7/h13-15H,10-12H2,1-7H3,(H2,22,23,24)/t14-,15+/m0/s1 |
| InChIKey | XZGAIODTKOVJJH-LSDHHAIUSA-N |
| XLogP | 2.83 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|