C14H17IN6O2 — CID 170521997
1-[(2R,4S)-4-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)-2-(trideuteriomethoxymethyl)pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 170521997) has the molecular formula C14H17IN6O2 and a molecular weight of 431.25 g/mol. Its IUPAC name is 1-[(2R,4S)-4-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)-2-(trideuteriomethoxymethyl)pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R,4S)-4-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)-2-(trideuteriomethoxymethyl)pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170521997 |
| Molecular Formula | C14H17IN6O2 |
| Molecular Weight | 431.25 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 1-[(2R,4S)-4-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)-2-(trideuteriomethoxymethyl)pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | [2H]C([2H])([2H])OC[C@H]1C[C@H](n2nc(I)c3c(N)ncnc32)CN1C(=O)C=C |
| InChI | InChI=1S/C14H17IN6O2/c1-3-10(22)20-5-8(4-9(20)6-23-2)21-14-11(12(15)19-21)13(16)17-7-18-14/h3,7-9H,1,4-6H2,2H3,(H2,16,17,18)/t8-,9+/m0/s1/i2D3 |
| InChIKey | WIFVTCBMOKMTRH-XURXTBIISA-N |
| XLogP | 0.99 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|