C25H26N8O2 — CID 170387924
1-[(2R)-4-[4-amino-3-[2-(2-methyl-3H-benzimidazol-5-yl)ethynyl]pyrazolo[3,4-d]pyrimidin-1-yl]-2-(2-methoxyethyl)pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 170387924) has the molecular formula C25H26N8O2 and a molecular weight of 470.54 g/mol. Its IUPAC name is 1-[(2R)-4-[4-amino-3-[2-(2-methyl-3H-benzimidazol-5-yl)ethynyl]pyrazolo[3,4-d]pyrimidin-1-yl]-2-(2-methoxyethyl)pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R)-4-[4-amino-3-[2-(2-methyl-3H-benzimidazol-5-yl)ethynyl]pyrazolo[3,4-d]pyrimidin-1-yl]-2-(2-methoxyethyl)pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170387924 |
| Molecular Formula | C25H26N8O2 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 1-[(2R)-4-[4-amino-3-[2-(2-methyl-3H-benzimidazol-5-yl)ethynyl]pyrazolo[3,4-d]pyrimidin-1-yl]-2-(2-methoxyethyl)pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(n2nc(C#Cc3ccc4nc(C)[nH]c4c3)c3c(N)ncnc32)C[C@@H]1CCOC |
| InChI | InChI=1S/C25H26N8O2/c1-4-22(34)32-13-18(12-17(32)9-10-35-3)33-25-23(24(26)27-14-28-25)20(31-33)8-6-16-5-7-19-21(11-16)30-15(2)29-19/h4-5,7,11,14,17-18H,1,9-10,12-13H2,2-3H3,(H,29,30)(H2,26,27,28)/t17-,18?/m0/s1 |
| InChIKey | DDYUSECLJRSHBU-ZENAZSQFSA-N |
| XLogP | 2.36 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|