C24H22N7O+ — CID 170387993
1-[3-[[4-amino-5-[2-(2-methyl-3H-benzimidazol-5-yl)ethynyl]pyrrolo[2,3-d]pyrimidin-7-ium-7-ylidene]methyl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 170387993) has the molecular formula C24H22N7O+ and a molecular weight of 424.49 g/mol. Its IUPAC name is 1-[3-[[4-amino-5-[2-(2-methyl-3H-benzimidazol-5-yl)ethynyl]pyrrolo[2,3-d]pyrimidin-7-ium-7-ylidene]methyl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[4-amino-5-[2-(2-methyl-3H-benzimidazol-5-yl)ethynyl]pyrrolo[2,3-d]pyrimidin-7-ium-7-ylidene]methyl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170387993 |
| Molecular Formula | C24H22N7O+ |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1-[3-[[4-amino-5-[2-(2-methyl-3H-benzimidazol-5-yl)ethynyl]pyrrolo[2,3-d]pyrimidin-7-ium-7-ylidene]methyl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(/C=[N+]2\C=C(C#Cc3ccc4nc(C)[nH]c4c3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C24H22N7O/c1-3-21(32)30-9-8-17(11-30)12-31-13-18(22-23(25)26-14-27-24(22)31)6-4-16-5-7-19-20(10-16)29-15(2)28-19/h3,5,7,10,12-14,17H,1,8-9,11H2,2H3,(H,28,29)(H2,25,26,27)/q+1/b31-12+ |
| InChIKey | MVNFNGAVCJNJGC-KLPHOBTLSA-N |
| XLogP | 2.40 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|