C23H24N8O — CID 170387973
1-[(3R)-3-[[6-amino-5-[3-(2-methyl-3H-benzimidazol-5-yl)prop-2-ynehydrazonoyl]pyrimidin-4-yl]methyl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 170387973) has the molecular formula C23H24N8O and a molecular weight of 428.50 g/mol. Its IUPAC name is 1-[(3R)-3-[[6-amino-5-[3-(2-methyl-3H-benzimidazol-5-yl)prop-2-ynehydrazonoyl]pyrimidin-4-yl]methyl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[[6-amino-5-[3-(2-methyl-3H-benzimidazol-5-yl)prop-2-ynehydrazonoyl]pyrimidin-4-yl]methyl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170387973 |
| Molecular Formula | C23H24N8O |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 1-[(3R)-3-[[6-amino-5-[3-(2-methyl-3H-benzimidazol-5-yl)prop-2-ynehydrazonoyl]pyrimidin-4-yl]methyl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@H](Cc2ncnc(N)c2/C(C#Cc2ccc3nc(C)[nH]c3c2)=N\N)C1 |
| InChI | InChI=1S/C23H24N8O/c1-3-21(32)31-9-8-16(12-31)11-20-22(23(24)27-13-26-20)18(30-25)7-5-15-4-6-17-19(10-15)29-14(2)28-17/h3-4,6,10,13,16H,1,8-9,11-12,25H2,2H3,(H,28,29)(H2,24,26,27)/b30-18-/t16-/m1/s1 |
| InChIKey | VESJNXVQRSSBGN-UYZRSVTCSA-N |
| XLogP | 1.54 |
| TPSA | 139.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|