C21H25N5O — CID 88960655
1-[3-[[[(4-amino-6-methylpyrimidin-5-yl)-phenylmethylidene]amino]methyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 88960655) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 1-[3-[[[(4-amino-6-methylpyrimidin-5-yl)-phenylmethylidene]amino]methyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[[(4-amino-6-methylpyrimidin-5-yl)-phenylmethylidene]amino]methyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 88960655 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 1-[3-[[[(4-amino-6-methylpyrimidin-5-yl)-phenylmethylidene]amino]methyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(C/N=C(\c2ccccc2)c2c(C)ncnc2N)C1 |
| InChI | InChI=1S/C21H25N5O/c1-3-18(27)26-11-7-8-16(13-26)12-23-20(17-9-5-4-6-10-17)19-15(2)24-14-25-21(19)22/h3-6,9-10,14,16H,1,7-8,11-13H2,2H3,(H2,22,24,25)/b23-20+ |
| InChIKey | GTKTXYGUEVXEDS-BSYVCWPDSA-N |
| XLogP | 2.63 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|