C32H42N6O2 — CID 145487034
(E)-4-(dimethylamino)-1-(3-methylpiperidin-1-yl)but-2-en-1-one;5-[N-ethyl-C-(4-phenoxyphenyl)carbonimidoyl]-6-methylpyrimidin-4-amine (PubChem CID 145487034) has the molecular formula C32H42N6O2 and a molecular weight of 542.73 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-1-(3-methylpiperidin-1-yl)but-2-en-1-one;5-[N-ethyl-C-(4-phenoxyphenyl)carbonimidoyl]-6-methylpyrimidin-4-amine.
| Compound Name | (E)-4-(dimethylamino)-1-(3-methylpiperidin-1-yl)but-2-en-1-one;5-[N-ethyl-C-(4-phenoxyphenyl)carbonimidoyl]-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 145487034 |
| Molecular Formula | C32H42N6O2 |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | (E)-4-(dimethylamino)-1-(3-methylpiperidin-1-yl)but-2-en-1-one;5-[N-ethyl-C-(4-phenoxyphenyl)carbonimidoyl]-6-methylpyrimidin-4-amine |
| SMILES | CC/N=C(\c1ccc(Oc2ccccc2)cc1)c1c(C)ncnc1N.CC1CCCN(C(=O)/C=C/CN(C)C)C1 |
| InChI | InChI=1S/C20H20N4O.C12H22N2O/c1-3-22-19(18-14(2)23-13-24-20(18)21)15-9-11-17(12-10-15)25-16-7-5-4-6-8-16;1-11-6-4-9-14(10-11)12(15)7-5-8-13(2)3/h4-13H,3H2,1-2H3,(H2,21,23,24);5,7,11H,4,6,8-10H2,1-3H3/b22-19+;7-5+ |
| InChIKey | KEWKXEVULDSLCX-JYEOKZCASA-N |
| XLogP | 5.38 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|