C28H29N5O3 — CID 90645796
(E)-4-(dimethylamino)-1-[(3S)-3-[4-(4-phenoxyphenoxy)pyrrolo[3,2-d]pyrimidin-5-yl]pyrrolidin-1-yl]but-2-en-1-one (PubChem CID 90645796) has the molecular formula C28H29N5O3 and a molecular weight of 483.57 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-1-[(3S)-3-[4-(4-phenoxyphenoxy)pyrrolo[3,2-d]pyrimidin-5-yl]pyrrolidin-1-yl]but-2-en-1-one.
| Compound Name | (E)-4-(dimethylamino)-1-[(3S)-3-[4-(4-phenoxyphenoxy)pyrrolo[3,2-d]pyrimidin-5-yl]pyrrolidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 90645796 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | (E)-4-(dimethylamino)-1-[(3S)-3-[4-(4-phenoxyphenoxy)pyrrolo[3,2-d]pyrimidin-5-yl]pyrrolidin-1-yl]but-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)N1CC[C@H](n2ccc3ncnc(Oc4ccc(Oc5ccccc5)cc4)c32)C1 |
| InChI | InChI=1S/C28H29N5O3/c1-31(2)16-6-9-26(34)32-17-14-21(19-32)33-18-15-25-27(33)28(30-20-29-25)36-24-12-10-23(11-13-24)35-22-7-4-3-5-8-22/h3-13,15,18,20-21H,14,16-17,19H2,1-2H3/b9-6+/t21-/m0/s1 |
| InChIKey | OACOEOMXRORVQN-JLXBBBJOSA-N |
| XLogP | 4.91 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|