C30H29N5O3 — CID 90646419
(E)-2-[4-[4-(4-phenoxyphenoxy)pyrrolo[3,2-d]pyrimidin-5-yl]piperidine-1-carbonyl]hex-2-enenitrile (PubChem CID 90646419) has the molecular formula C30H29N5O3 and a molecular weight of 507.59 g/mol. Its IUPAC name is (E)-2-[4-[4-(4-phenoxyphenoxy)pyrrolo[3,2-d]pyrimidin-5-yl]piperidine-1-carbonyl]hex-2-enenitrile.
| Compound Name | (E)-2-[4-[4-(4-phenoxyphenoxy)pyrrolo[3,2-d]pyrimidin-5-yl]piperidine-1-carbonyl]hex-2-enenitrile |
|---|---|
| PubChem CID | 90646419 |
| Molecular Formula | C30H29N5O3 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | (E)-2-[4-[4-(4-phenoxyphenoxy)pyrrolo[3,2-d]pyrimidin-5-yl]piperidine-1-carbonyl]hex-2-enenitrile |
| SMILES | CCC/C=C(\C#N)C(=O)N1CCC(n2ccc3ncnc(Oc4ccc(Oc5ccccc5)cc4)c32)CC1 |
| InChI | InChI=1S/C30H29N5O3/c1-2-3-7-22(20-31)30(36)34-17-14-23(15-18-34)35-19-16-27-28(35)29(33-21-32-27)38-26-12-10-25(11-13-26)37-24-8-5-4-6-9-24/h4-13,16,19,21,23H,2-3,14-15,17-18H2,1H3/b22-7+ |
| InChIKey | OPJYVZNVLRYURZ-QPJQQBGISA-N |
| XLogP | 6.43 |
| TPSA | 93.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|