C23H22FN5O3 — CID 175458970
1-[3-[4-amino-5-[2-(3,5-dimethoxyphenyl)ethynyl]-6-fluoropyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 175458970) has the molecular formula C23H22FN5O3 and a molecular weight of 435.46 g/mol. Its IUPAC name is 1-[3-[4-amino-5-[2-(3,5-dimethoxyphenyl)ethynyl]-6-fluoropyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-amino-5-[2-(3,5-dimethoxyphenyl)ethynyl]-6-fluoropyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 175458970 |
| Molecular Formula | C23H22FN5O3 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 1-[3-[4-amino-5-[2-(3,5-dimethoxyphenyl)ethynyl]-6-fluoropyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(n2c(F)c(C#Cc3cc(OC)cc(OC)c3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C23H22FN5O3/c1-4-19(30)28-8-7-15(12-28)29-21(24)18(20-22(25)26-13-27-23(20)29)6-5-14-9-16(31-2)11-17(10-14)32-3/h4,9-11,13,15H,1,7-8,12H2,2-3H3,(H2,25,26,27) |
| InChIKey | HQAAYUHLSAXKKQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|