C22H24N6O3 — CID 167634793
3-[2-(3,5-dimethoxyphenyl)ethynyl]-2H-pyrazolo[3,4-d]pyrimidin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 167634793) has the molecular formula C22H24N6O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is 3-[2-(3,5-dimethoxyphenyl)ethynyl]-2H-pyrazolo[3,4-d]pyrimidin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one.
| Compound Name | 3-[2-(3,5-dimethoxyphenyl)ethynyl]-2H-pyrazolo[3,4-d]pyrimidin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 167634793 |
| Molecular Formula | C22H24N6O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 3-[2-(3,5-dimethoxyphenyl)ethynyl]-2H-pyrazolo[3,4-d]pyrimidin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC1.COc1cc(C#Cc2[nH]nc3ncnc(N)c23)cc(OC)c1 |
| InChI | InChI=1S/C15H13N5O2.C7H11NO/c1-21-10-5-9(6-11(7-10)22-2)3-4-12-13-14(16)17-8-18-15(13)20-19-12;1-2-7(9)8-5-3-4-6-8/h5-8H,1-2H3,(H3,16,17,18,19,20);2H,1,3-6H2 |
| InChIKey | OHYXULUTRUGJKA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|