About ethane;3-methyl-2H-pyrazolo[4,3-c]pyridin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one
ethane;3-methyl-2H-pyrazolo[4,3-c]pyridin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 162382408) has the molecular formula C16H25N5O
and a molecular weight of 303.41 g/mol. Its IUPAC name is ethane;3-methyl-2H-pyrazolo[4,3-c]pyridin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one.
Molecular Properties
| Compound Name | ethane;3-methyl-2H-pyrazolo[4,3-c]pyridin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one |
| PubChem CID | 162382408 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | ethane;3-methyl-2H-pyrazolo[4,3-c]pyridin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC1.CC.Cc1[nH]nc2ccnc(N)c12 |
| InChI | InChI=1S/C7H8N4.C7H11NO.C2H6/c1-4-6-5(11-10-4)2-3-9-7(6)8;1-2-7(9)8-5-3-4-6-8;1-2/h2-3H,1H3,(H2,8,9)(H,10,11);2H,1,3-6H2;1-2H3 |
| InChIKey | IUHVAEPTKIQJBA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methyl-2H-pyrazolo[4,3-c]pyridin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-2H-pyrazolo[4,3-c]pyridin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one?
The IUPAC name of ethane;3-methyl-2H-pyrazolo[4,3-c]pyridin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one (CID 162382408) is ethane;3-methyl-2H-pyrazolo[4,3-c]pyridin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one.
What is the SMILES notation for ethane;3-methyl-2H-pyrazolo[4,3-c]pyridin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one?
The canonical SMILES for ethane;3-methyl-2H-pyrazolo[4,3-c]pyridin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one is C=CC(=O)N1CCCC1.CC.Cc1[nH]nc2ccnc(N)c12.
What is the InChIKey of ethane;3-methyl-2H-pyrazolo[4,3-c]pyridin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one?
The InChIKey is IUHVAEPTKIQJBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4.C7H11NO.C2H6/c1-4-6-5(11-10-4)2-3-9-7(6)8;1-2-7(9)8-5-3-4-6-8;1-2/h2-3H,1H3,(H2,8,9)(H,10,11);2H,1,3-6H2;1-2H3.
What are the key properties of ethane;3-methyl-2H-pyrazolo[4,3-c]pyridin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one?
ethane;3-methyl-2H-pyrazolo[4,3-c]pyridin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one has a molecular weight of 303.41 g/mol, XLogP of 2.67, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-2H-pyrazolo[4,3-c]pyridin-4-amine;1-pyrrolidin-1-ylprop-2-en-1-one is sourced from PubChem (CID 162382408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).