C14H24BrN5O2 — CID 162380772
5-bromo-3-(methylamino)-1H-pyrazole-4-carboxamide;ethane;1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 162380772) has the molecular formula C14H24BrN5O2 and a molecular weight of 374.28 g/mol. Its IUPAC name is 5-bromo-3-(methylamino)-1H-pyrazole-4-carboxamide;ethane;1-pyrrolidin-1-ylprop-2-en-1-one.
| Compound Name | 5-bromo-3-(methylamino)-1H-pyrazole-4-carboxamide;ethane;1-pyrrolidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 162380772 |
| Molecular Formula | C14H24BrN5O2 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 5-bromo-3-(methylamino)-1H-pyrazole-4-carboxamide;ethane;1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC1.CC.CNc1n[nH]c(Br)c1C(N)=O |
| InChI | InChI=1S/C7H11NO.C5H7BrN4O.C2H6/c1-2-7(9)8-5-3-4-6-8;1-8-5-2(4(7)11)3(6)9-10-5;1-2/h2H,1,3-6H2;1H3,(H2,7,11)(H2,8,9,10);1-2H3 |
| InChIKey | CMQKOVXHZCTFBC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|