C15H28N2O — CID 175432940
4,4-dimethylpiperidine;1-piperidin-1-ylprop-2-en-1-one (PubChem CID 175432940) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 4,4-dimethylpiperidine;1-piperidin-1-ylprop-2-en-1-one.
| Compound Name | 4,4-dimethylpiperidine;1-piperidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 175432940 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 4,4-dimethylpiperidine;1-piperidin-1-ylprop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCCC1.CC1(C)CCNCC1 |
| InChI | InChI=1S/C8H13NO.C7H15N/c1-2-8(10)9-6-4-3-5-7-9;1-7(2)3-5-8-6-4-7/h2H,1,3-7H2;8H,3-6H2,1-2H3 |
| InChIKey | OKUKGHYTEUGBOG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|