C13H18BNO — CID 169213217
CID 169213217 (PubChem CID 169213217) has the molecular formula C13H18BNO and a molecular weight of 215.10 g/mol.
| Compound Name | CID 169213217 |
|---|---|
| PubChem CID | 169213217 |
| Molecular Formula | C13H18BNO |
| Molecular Weight | 215.10 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | — |
| SMILES | [B]C1=CCC2(CC1)CCN(C(=O)C=C)CC2 |
| InChI | InChI=1S/C13H18BNO/c1-2-12(16)15-9-7-13(8-10-15)5-3-11(14)4-6-13/h2-3H,1,4-10H2 |
| InChIKey | LRZBQDFNNTWIMJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.10 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|