C11H20N2O — CID 176701757
1-(2,6-diazaspiro[3.4]octan-6-yl)prop-2-en-1-one;ethane (PubChem CID 176701757) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-(2,6-diazaspiro[3.4]octan-6-yl)prop-2-en-1-one;ethane.
| Compound Name | 1-(2,6-diazaspiro[3.4]octan-6-yl)prop-2-en-1-one;ethane |
|---|---|
| PubChem CID | 176701757 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-(2,6-diazaspiro[3.4]octan-6-yl)prop-2-en-1-one;ethane |
| SMILES | C=CC(=O)N1CCC2(CNC2)C1.CC |
| InChI | InChI=1S/C9H14N2O.C2H6/c1-2-8(12)11-4-3-9(7-11)5-10-6-9;1-2/h2,10H,1,3-7H2;1-2H3 |
| InChIKey | MHQNQZKKGNDEAD-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|