C15H23NO — CID 171535768
1-(4,9-dimethyl-3-azaspiro[5.5]undec-9-en-3-yl)prop-2-en-1-one (PubChem CID 171535768) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 1-(4,9-dimethyl-3-azaspiro[5.5]undec-9-en-3-yl)prop-2-en-1-one.
| Compound Name | 1-(4,9-dimethyl-3-azaspiro[5.5]undec-9-en-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 171535768 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 1-(4,9-dimethyl-3-azaspiro[5.5]undec-9-en-3-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC2(CC=C(C)CC2)CC1C |
| InChI | InChI=1S/C15H23NO/c1-4-14(17)16-10-9-15(11-13(16)3)7-5-12(2)6-8-15/h4-5,13H,1,6-11H2,2-3H3 |
| InChIKey | UQTRUNWTWADDKE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|