C8H13NO3S — CID 102883016
1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)prop-2-en-1-one (PubChem CID 102883016) has the molecular formula C8H13NO3S and a molecular weight of 203.26 g/mol. Its IUPAC name is 1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)prop-2-en-1-one.
| Compound Name | 1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 102883016 |
| Molecular Formula | C8H13NO3S |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCS(=O)(=O)CC1C |
| InChI | InChI=1S/C8H13NO3S/c1-3-8(10)9-4-5-13(11,12)6-7(9)2/h3,7H,1,4-6H2,2H3 |
| InChIKey | JBXCFHMSXXJQAZ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|