C11H18N2O3S2 — CID 102883447
1-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)cyclobutane-1-carbothioamide (PubChem CID 102883447) has the molecular formula C11H18N2O3S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)cyclobutane-1-carbothioamide.
| Compound Name | 1-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)cyclobutane-1-carbothioamide |
|---|---|
| PubChem CID | 102883447 |
| Molecular Formula | C11H18N2O3S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 1-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)cyclobutane-1-carbothioamide |
| SMILES | CC1CS(=O)(=O)CCN1C(=O)C1(C(N)=S)CCC1 |
| InChI | InChI=1S/C11H18N2O3S2/c1-8-7-18(15,16)6-5-13(8)10(14)11(9(12)17)3-2-4-11/h8H,2-7H2,1H3,(H2,12,17) |
| InChIKey | CSJLKZKWLJKTMZ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|