C16H28N2OS — CID 104967482
1-[(2S,6R)-2,6-dimethylpiperidine-1-carbonyl]cycloheptane-1-carbothioamide (PubChem CID 104967482) has the molecular formula C16H28N2OS and a molecular weight of 296.48 g/mol. Its IUPAC name is 1-[(2S,6R)-2,6-dimethylpiperidine-1-carbonyl]cycloheptane-1-carbothioamide.
| Compound Name | 1-[(2S,6R)-2,6-dimethylpiperidine-1-carbonyl]cycloheptane-1-carbothioamide |
|---|---|
| PubChem CID | 104967482 |
| Molecular Formula | C16H28N2OS |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 1-[(2S,6R)-2,6-dimethylpiperidine-1-carbonyl]cycloheptane-1-carbothioamide |
| SMILES | C[C@@H]1CCC[C@H](C)N1C(=O)C1(C(N)=S)CCCCCC1 |
| InChI | InChI=1S/C16H28N2OS/c1-12-8-7-9-13(2)18(12)15(19)16(14(17)20)10-5-3-4-6-11-16/h12-13H,3-11H2,1-2H3,(H2,17,20)/t12-,13+ |
| InChIKey | SHSCHQCIMSDBPU-BETUJISGSA-N |
| XLogP | 3.40 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|