C14H24N2O2S — CID 104967489
4-[(2R,6S)-2,6-dimethylpiperidine-1-carbonyl]oxane-4-carbothioamide (PubChem CID 104967489) has the molecular formula C14H24N2O2S and a molecular weight of 284.43 g/mol. Its IUPAC name is 4-[(2R,6S)-2,6-dimethylpiperidine-1-carbonyl]oxane-4-carbothioamide.
| Compound Name | 4-[(2R,6S)-2,6-dimethylpiperidine-1-carbonyl]oxane-4-carbothioamide |
|---|---|
| PubChem CID | 104967489 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 4-[(2R,6S)-2,6-dimethylpiperidine-1-carbonyl]oxane-4-carbothioamide |
| SMILES | C[C@@H]1CCC[C@H](C)N1C(=O)C1(C(N)=S)CCOCC1 |
| InChI | InChI=1S/C14H24N2O2S/c1-10-4-3-5-11(2)16(10)13(17)14(12(15)19)6-8-18-9-7-14/h10-11H,3-9H2,1-2H3,(H2,15,19)/t10-,11+ |
| InChIKey | DNTMSWBGAKWHSY-PHIMTYICSA-N |
| XLogP | 1.86 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|