C13H23N3OS — CID 114536931
1-(3,4,5-trimethylpiperazine-1-carbonyl)cyclobutane-1-carbothioamide (PubChem CID 114536931) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is 1-(3,4,5-trimethylpiperazine-1-carbonyl)cyclobutane-1-carbothioamide.
| Compound Name | 1-(3,4,5-trimethylpiperazine-1-carbonyl)cyclobutane-1-carbothioamide |
|---|---|
| PubChem CID | 114536931 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 1-(3,4,5-trimethylpiperazine-1-carbonyl)cyclobutane-1-carbothioamide |
| SMILES | CC1CN(C(=O)C2(C(N)=S)CCC2)CC(C)N1C |
| InChI | InChI=1S/C13H23N3OS/c1-9-7-16(8-10(2)15(9)3)12(17)13(11(14)18)5-4-6-13/h9-10H,4-8H2,1-3H3,(H2,14,18) |
| InChIKey | XULJJEAFPYHNKI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|