C13H22N2O3S — CID 104958745
4-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]oxane-4-carbothioamide (PubChem CID 104958745) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is 4-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]oxane-4-carbothioamide.
| Compound Name | 4-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]oxane-4-carbothioamide |
|---|---|
| PubChem CID | 104958745 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 4-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]oxane-4-carbothioamide |
| SMILES | C[C@@H]1CN(C(=O)C2(C(N)=S)CCOCC2)C[C@H](C)O1 |
| InChI | InChI=1S/C13H22N2O3S/c1-9-7-15(8-10(2)18-9)12(16)13(11(14)19)3-5-17-6-4-13/h9-10H,3-8H2,1-2H3,(H2,14,19)/t9-,10+ |
| InChIKey | LTHAZHDCAXXFOP-AOOOYVTPSA-N |
| XLogP | 0.71 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|