C7H14N2O2S — CID 102887181
1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)ethanimine (PubChem CID 102887181) has the molecular formula C7H14N2O2S and a molecular weight of 190.27 g/mol. Its IUPAC name is 1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)ethanimine.
| Compound Name | 1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)ethanimine |
|---|---|
| PubChem CID | 102887181 |
| Molecular Formula | C7H14N2O2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)ethanimine |
| SMILES | [H]/N=C(\C)N1CCS(=O)(=O)CC1C |
| InChI | InChI=1S/C7H14N2O2S/c1-6-5-12(10,11)4-3-9(6)7(2)8/h6,8H,3-5H2,1-2H3/b8-7+ |
| InChIKey | MTYZORFDDXYFEF-BQYQJAHWSA-N |
| XLogP | 0.10 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|