C10H20N2O2S2 — CID 102883053
3-methyl-N-(2-methylpropyl)-1,1-dioxo-1,4-thiazinane-4-carbothioamide (PubChem CID 102883053) has the molecular formula C10H20N2O2S2 and a molecular weight of 264.42 g/mol. Its IUPAC name is 3-methyl-N-(2-methylpropyl)-1,1-dioxo-1,4-thiazinane-4-carbothioamide.
| Compound Name | 3-methyl-N-(2-methylpropyl)-1,1-dioxo-1,4-thiazinane-4-carbothioamide |
|---|---|
| PubChem CID | 102883053 |
| Molecular Formula | C10H20N2O2S2 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3-methyl-N-(2-methylpropyl)-1,1-dioxo-1,4-thiazinane-4-carbothioamide |
| SMILES | CC(C)CNC(=S)N1CCS(=O)(=O)CC1C |
| InChI | InChI=1S/C10H20N2O2S2/c1-8(2)6-11-10(15)12-4-5-16(13,14)7-9(12)3/h8-9H,4-7H2,1-3H3,(H,11,15) |
| InChIKey | VNKVNYSZJKLZBG-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|