C10H20N2O2S2 — CID 102883055
N-butyl-3-methyl-1,1-dioxo-1,4-thiazinane-4-carbothioamide (PubChem CID 102883055) has the molecular formula C10H20N2O2S2 and a molecular weight of 264.42 g/mol. Its IUPAC name is N-butyl-3-methyl-1,1-dioxo-1,4-thiazinane-4-carbothioamide.
| Compound Name | N-butyl-3-methyl-1,1-dioxo-1,4-thiazinane-4-carbothioamide |
|---|---|
| PubChem CID | 102883055 |
| Molecular Formula | C10H20N2O2S2 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | N-butyl-3-methyl-1,1-dioxo-1,4-thiazinane-4-carbothioamide |
| SMILES | CCCCNC(=S)N1CCS(=O)(=O)CC1C |
| InChI | InChI=1S/C10H20N2O2S2/c1-3-4-5-11-10(15)12-6-7-16(13,14)8-9(12)2/h9H,3-8H2,1-2H3,(H,11,15) |
| InChIKey | KQWAZAZEIUQAKN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|