C10H19N3OS — CID 94171194
(2R)-1-(butylcarbamothioyl)pyrrolidine-2-carboxamide (PubChem CID 94171194) has the molecular formula C10H19N3OS and a molecular weight of 229.35 g/mol. Its IUPAC name is (2R)-1-(butylcarbamothioyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-(butylcarbamothioyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 94171194 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | (2R)-1-(butylcarbamothioyl)pyrrolidine-2-carboxamide |
| SMILES | CCCCNC(=S)N1CCC[C@@H]1C(N)=O |
| InChI | InChI=1S/C10H19N3OS/c1-2-3-6-12-10(15)13-7-4-5-8(13)9(11)14/h8H,2-7H2,1H3,(H2,11,14)(H,12,15)/t8-/m1/s1 |
| InChIKey | GAAZQKSXCBRSIY-MRVPVSSYSA-N |
| XLogP | 0.61 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|