C22H43N3O2S — CID 156846172
(2S)-1-(butylcarbamothioyl)-N-[(4R)-2,6-dimethyl-3-oxohept-1-en-4-yl]-N-methylpyrrolidine-2-carboxamide;ethane;molecular hydrogen (PubChem CID 156846172) has the molecular formula C22H43N3O2S and a molecular weight of 413.67 g/mol. Its IUPAC name is (2S)-1-(butylcarbamothioyl)-N-[(4R)-2,6-dimethyl-3-oxohept-1-en-4-yl]-N-methylpyrrolidine-2-carboxamide;ethane;molecular hydrogen.
| Compound Name | (2S)-1-(butylcarbamothioyl)-N-[(4R)-2,6-dimethyl-3-oxohept-1-en-4-yl]-N-methylpyrrolidine-2-carboxamide;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 156846172 |
| Molecular Formula | C22H43N3O2S |
| Molecular Weight | 413.67 g/mol |
| Exact Mass | 413.31 |
| IUPAC Name | (2S)-1-(butylcarbamothioyl)-N-[(4R)-2,6-dimethyl-3-oxohept-1-en-4-yl]-N-methylpyrrolidine-2-carboxamide;ethane;molecular hydrogen |
| SMILES | C=C(C)C(=O)[C@@H](CC(C)C)N(C)C(=O)[C@@H]1CCCN1C(=S)NCCCC.CC.[H][H] |
| InChI | InChI=1S/C20H35N3O2S.C2H6.H2/c1-7-8-11-21-20(26)23-12-9-10-16(23)19(25)22(6)17(13-14(2)3)18(24)15(4)5;1-2;/h14,16-17H,4,7-13H2,1-3,5-6H3,(H,21,26);1-2H3;1H/t16-,17+;;/m0../s1 |
| InChIKey | PNZUCQYURASRGG-UXHRTOHASA-N |
| XLogP | 4.42 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.67 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|