About N-butyl-1-methylpyrrolidine-2-carboxamide;ethane;formaldehyde
N-butyl-1-methylpyrrolidine-2-carboxamide;ethane;formaldehyde (PubChem CID 142213067) has the molecular formula C13H28N2O2
and a molecular weight of 244.38 g/mol. Its IUPAC name is N-butyl-1-methylpyrrolidine-2-carboxamide;ethane;formaldehyde.
Molecular Properties
| Compound Name | N-butyl-1-methylpyrrolidine-2-carboxamide;ethane;formaldehyde |
| PubChem CID | 142213067 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | N-butyl-1-methylpyrrolidine-2-carboxamide;ethane;formaldehyde |
| SMILES | C=O.CC.CCCCNC(=O)C1CCCN1C |
| InChI | InChI=1S/C10H20N2O.C2H6.CH2O/c1-3-4-7-11-10(13)9-6-5-8-12(9)2;2*1-2/h9H,3-8H2,1-2H3,(H,11,13);1-2H3;1H2 |
| InChIKey | KUVUOWOHUHKFOE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-1-methylpyrrolidine-2-carboxamide;ethane;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-1-methylpyrrolidine-2-carboxamide;ethane;formaldehyde?
The IUPAC name of N-butyl-1-methylpyrrolidine-2-carboxamide;ethane;formaldehyde (CID 142213067) is N-butyl-1-methylpyrrolidine-2-carboxamide;ethane;formaldehyde.
What is the SMILES notation for N-butyl-1-methylpyrrolidine-2-carboxamide;ethane;formaldehyde?
The canonical SMILES for N-butyl-1-methylpyrrolidine-2-carboxamide;ethane;formaldehyde is C=O.CC.CCCCNC(=O)C1CCCN1C.
What is the InChIKey of N-butyl-1-methylpyrrolidine-2-carboxamide;ethane;formaldehyde?
The InChIKey is KUVUOWOHUHKFOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O.C2H6.CH2O/c1-3-4-7-11-10(13)9-6-5-8-12(9)2;2*1-2/h9H,3-8H2,1-2H3,(H,11,13);1-2H3;1H2.
What are the key properties of N-butyl-1-methylpyrrolidine-2-carboxamide;ethane;formaldehyde?
N-butyl-1-methylpyrrolidine-2-carboxamide;ethane;formaldehyde has a molecular weight of 244.38 g/mol, XLogP of 1.84, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-1-methylpyrrolidine-2-carboxamide;ethane;formaldehyde is sourced from PubChem (CID 142213067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).