C12H27N3O — CID 143685494
N-[2-(dimethylamino)ethyl]-1-methylpyrrolidine-2-carboxamide;ethane (PubChem CID 143685494) has the molecular formula C12H27N3O and a molecular weight of 229.37 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-1-methylpyrrolidine-2-carboxamide;ethane.
| Compound Name | N-[2-(dimethylamino)ethyl]-1-methylpyrrolidine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 143685494 |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-1-methylpyrrolidine-2-carboxamide;ethane |
| SMILES | CC.CN(C)CCNC(=O)C1CCCN1C |
| InChI | InChI=1S/C10H21N3O.C2H6/c1-12(2)8-6-11-10(14)9-5-4-7-13(9)3;1-2/h9H,4-8H2,1-3H3,(H,11,14);1-2H3 |
| InChIKey | CBRDQVVIMHNYRA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |