C12H26N4O2S — CID 143879715
(2S)-1-[2-(carbamothioylamino)acetyl]pyrrolidine-2-carboxamide;ethane (PubChem CID 143879715) has the molecular formula C12H26N4O2S and a molecular weight of 290.43 g/mol. Its IUPAC name is (2S)-1-[2-(carbamothioylamino)acetyl]pyrrolidine-2-carboxamide;ethane.
| Compound Name | (2S)-1-[2-(carbamothioylamino)acetyl]pyrrolidine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 143879715 |
| Molecular Formula | C12H26N4O2S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | (2S)-1-[2-(carbamothioylamino)acetyl]pyrrolidine-2-carboxamide;ethane |
| SMILES | CC.CC.NC(=O)[C@@H]1CCCN1C(=O)CNC(N)=S |
| InChI | InChI=1S/C8H14N4O2S.2C2H6/c9-7(14)5-2-1-3-12(5)6(13)4-11-8(10)15;2*1-2/h5H,1-4H2,(H2,9,14)(H3,10,11,15);2*1-2H3/t5-;;/m0../s1 |
| InChIKey | VZGSKDNVQZNYBZ-XRIGFGBMSA-N |
| XLogP | 0.35 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|