C8H14ClNO3S — CID 102883010
3-chloro-1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propan-1-one (PubChem CID 102883010) has the molecular formula C8H14ClNO3S and a molecular weight of 239.72 g/mol. Its IUPAC name is 3-chloro-1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propan-1-one.
| Compound Name | 3-chloro-1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propan-1-one |
|---|---|
| PubChem CID | 102883010 |
| Molecular Formula | C8H14ClNO3S |
| Molecular Weight | 239.72 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 3-chloro-1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propan-1-one |
| SMILES | CC1CS(=O)(=O)CCN1C(=O)CCCl |
| InChI | InChI=1S/C8H14ClNO3S/c1-7-6-14(12,13)5-4-10(7)8(11)2-3-9/h7H,2-6H2,1H3 |
| InChIKey | ACBLPMLDMQFHOL-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.72 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|