C25H27N7O3 — CID 138717895
(E)-1-[3-[4-amino-3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazolo[3,4-d]pyrimidin-1-yl]azetidin-1-yl]-4-(azetidin-1-yl)but-2-en-1-one (PubChem CID 138717895) has the molecular formula C25H27N7O3 and a molecular weight of 473.54 g/mol. Its IUPAC name is (E)-1-[3-[4-amino-3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazolo[3,4-d]pyrimidin-1-yl]azetidin-1-yl]-4-(azetidin-1-yl)but-2-en-1-one.
| Compound Name | (E)-1-[3-[4-amino-3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazolo[3,4-d]pyrimidin-1-yl]azetidin-1-yl]-4-(azetidin-1-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 138717895 |
| Molecular Formula | C25H27N7O3 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | (E)-1-[3-[4-amino-3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazolo[3,4-d]pyrimidin-1-yl]azetidin-1-yl]-4-(azetidin-1-yl)but-2-en-1-one |
| SMILES | COc1cc(C#Cc2nn(C3CN(C(=O)/C=C/CN4CCC4)C3)c3ncnc(N)c23)cc(OC)c1 |
| InChI | InChI=1S/C25H27N7O3/c1-34-19-11-17(12-20(13-19)35-2)6-7-21-23-24(26)27-16-28-25(23)32(29-21)18-14-31(15-18)22(33)5-3-8-30-9-4-10-30/h3,5,11-13,16,18H,4,8-10,14-15H2,1-2H3,(H2,26,27,28)/b5-3+ |
| InChIKey | RMOPFBRCISQCEG-HWKANZROSA-N |
| XLogP | 1.47 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|