C27H32N6O2 — CID 167097011
1-[(3S)-1-(3-cyclobutylcyclobutyl)pyrrolidin-3-yl]-3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 167097011) has the molecular formula C27H32N6O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 1-[(3S)-1-(3-cyclobutylcyclobutyl)pyrrolidin-3-yl]-3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-[(3S)-1-(3-cyclobutylcyclobutyl)pyrrolidin-3-yl]-3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 167097011 |
| Molecular Formula | C27H32N6O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 1-[(3S)-1-(3-cyclobutylcyclobutyl)pyrrolidin-3-yl]-3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | COc1cc(C#Cc2nn([C@H]3CCN(C4CC(C5CCC5)C4)C3)c3ncnc(N)c23)cc(OC)c1 |
| InChI | InChI=1S/C27H32N6O2/c1-34-22-10-17(11-23(14-22)35-2)6-7-24-25-26(28)29-16-30-27(25)33(31-24)20-8-9-32(15-20)21-12-19(13-21)18-4-3-5-18/h10-11,14,16,18-21H,3-5,8-9,12-13,15H2,1-2H3,(H2,28,29,30)/t19?,20-,21?/m0/s1 |
| InChIKey | VZCJCBSGRLGQQT-KBWCOIMZSA-N |
| XLogP | 3.65 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|