C23H26N6O4 — CID 174223191
4-amino-6-[2-(3,5-dimethoxyphenyl)ethynyl]-2-[(1-prop-2-enoylpiperidin-3-yl)amino]pyrimidine-5-carboxamide (PubChem CID 174223191) has the molecular formula C23H26N6O4 and a molecular weight of 450.50 g/mol. Its IUPAC name is 4-amino-6-[2-(3,5-dimethoxyphenyl)ethynyl]-2-[(1-prop-2-enoylpiperidin-3-yl)amino]pyrimidine-5-carboxamide.
| Compound Name | 4-amino-6-[2-(3,5-dimethoxyphenyl)ethynyl]-2-[(1-prop-2-enoylpiperidin-3-yl)amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 174223191 |
| Molecular Formula | C23H26N6O4 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 4-amino-6-[2-(3,5-dimethoxyphenyl)ethynyl]-2-[(1-prop-2-enoylpiperidin-3-yl)amino]pyrimidine-5-carboxamide |
| SMILES | C=CC(=O)N1CCCC(Nc2nc(N)c(C(N)=O)c(C#Cc3cc(OC)cc(OC)c3)n2)C1 |
| InChI | InChI=1S/C23H26N6O4/c1-4-19(30)29-9-5-6-15(13-29)26-23-27-18(20(22(25)31)21(24)28-23)8-7-14-10-16(32-2)12-17(11-14)33-3/h4,10-12,15H,1,5-6,9,13H2,2-3H3,(H2,25,31)(H3,24,26,27,28) |
| InChIKey | PHHFYRLXMSTSGI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 145.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|